C19H18BrN3O4 — CID 35552842
(3R)-N'-(2-bromobenzoyl)-1-(4-methoxyphenyl)-5-oxopyrrolidine-3-carbohydrazide (PubChem CID 35552842) has the molecular formula C19H18BrN3O4 and a molecular weight of 432.27 g/mol. Its IUPAC name is (3R)-N'-(2-bromobenzoyl)-1-(4-methoxyphenyl)-5-oxopyrrolidine-3-carbohydrazide.
| Compound Name | (3R)-N'-(2-bromobenzoyl)-1-(4-methoxyphenyl)-5-oxopyrrolidine-3-carbohydrazide |
|---|---|
| PubChem CID | 35552842 |
| Molecular Formula | C19H18BrN3O4 |
| Molecular Weight | 432.27 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | (3R)-N'-(2-bromobenzoyl)-1-(4-methoxyphenyl)-5-oxopyrrolidine-3-carbohydrazide |
| SMILES | COc1ccc(N2C[C@H](C(=O)NNC(=O)c3ccccc3Br)CC2=O)cc1 |
| InChI | InChI=1S/C19H18BrN3O4/c1-27-14-8-6-13(7-9-14)23-11-12(10-17(23)24)18(25)21-22-19(26)15-4-2-3-5-16(15)20/h2-9,12H,10-11H2,1H3,(H,21,25)(H,22,26)/t12-/m1/s1 |
| InChIKey | CTFAKZHYVMECEE-GFCCVEGCSA-N |
| XLogP | 2.27 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|