C22H22N2O3S — CID 35580659
(1R,8R,9S,13R)-1-ethylsulfanyl-11-(4-methoxyphenyl)-14-methyl-11,14-diazatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione (PubChem CID 35580659) has the molecular formula C22H22N2O3S and a molecular weight of 394.50 g/mol. Its IUPAC name is (1R,8R,9S,13R)-1-ethylsulfanyl-11-(4-methoxyphenyl)-14-methyl-11,14-diazatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione.
| Compound Name | (1R,8R,9S,13R)-1-ethylsulfanyl-11-(4-methoxyphenyl)-14-methyl-11,14-diazatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione |
|---|---|
| PubChem CID | 35580659 |
| Molecular Formula | C22H22N2O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | (1R,8R,9S,13R)-1-ethylsulfanyl-11-(4-methoxyphenyl)-14-methyl-11,14-diazatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione |
| SMILES | CCS[C@@]12c3ccccc3[C@@H]([C@H]3C(=O)N(c4ccc(OC)cc4)C(=O)[C@@H]31)N2C |
| InChI | InChI=1S/C22H22N2O3S/c1-4-28-22-16-8-6-5-7-15(16)19(23(22)2)17-18(22)21(26)24(20(17)25)13-9-11-14(27-3)12-10-13/h5-12,17-19H,4H2,1-3H3/t17-,18+,19-,22-/m0/s1 |
| InChIKey | ZHXFWAUNAFIGKO-WEMPKCCASA-N |
| XLogP | 3.41 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|