C16H20N2O3S — CID 35595783
N-(2,5-diethoxyphenyl)-2-(2-methyl-1,3-thiazol-4-yl)acetamide (PubChem CID 35595783) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is N-(2,5-diethoxyphenyl)-2-(2-methyl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-(2,5-diethoxyphenyl)-2-(2-methyl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 35595783 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | N-(2,5-diethoxyphenyl)-2-(2-methyl-1,3-thiazol-4-yl)acetamide |
| SMILES | CCOc1ccc(OCC)c(NC(=O)Cc2csc(C)n2)c1 |
| InChI | InChI=1S/C16H20N2O3S/c1-4-20-13-6-7-15(21-5-2)14(9-13)18-16(19)8-12-10-22-11(3)17-12/h6-7,9-10H,4-5,8H2,1-3H3,(H,18,19) |
| InChIKey | NKDFKBGGXXAILL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |