C17H16Cl2FN3O3S — CID 35605837
(3,6-dichloro-2-pyridinyl)-[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]methanone (PubChem CID 35605837) has the molecular formula C17H16Cl2FN3O3S and a molecular weight of 432.30 g/mol. Its IUPAC name is (3,6-dichloro-2-pyridinyl)-[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]methanone.
| Compound Name | (3,6-dichloro-2-pyridinyl)-[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 35605837 |
| Molecular Formula | C17H16Cl2FN3O3S |
| Molecular Weight | 432.30 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | (3,6-dichloro-2-pyridinyl)-[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]methanone |
| SMILES | O=C(c1nc(Cl)ccc1Cl)N1CCCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C17H16Cl2FN3O3S/c18-14-6-7-15(19)21-16(14)17(24)22-8-1-9-23(11-10-22)27(25,26)13-4-2-12(20)3-5-13/h2-7H,1,8-11H2 |
| InChIKey | HNSPNCMNZMTQBU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|