C18H24N2OS — CID 3561121
5-[(4-tert-butylphenyl)methylidene]-1-methyl-3-propan-2-yl-2-sulfanylideneimidazolidin-4-one (PubChem CID 3561121) has the molecular formula C18H24N2OS and a molecular weight of 316.47 g/mol. Its IUPAC name is 5-[(4-tert-butylphenyl)methylidene]-1-methyl-3-propan-2-yl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 5-[(4-tert-butylphenyl)methylidene]-1-methyl-3-propan-2-yl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 3561121 |
| Molecular Formula | C18H24N2OS |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 5-[(4-tert-butylphenyl)methylidene]-1-methyl-3-propan-2-yl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CC(C)N1C(=O)C(=Cc2ccc(C(C)(C)C)cc2)N(C)C1=S |
| InChI | InChI=1S/C18H24N2OS/c1-12(2)20-16(21)15(19(6)17(20)22)11-13-7-9-14(10-8-13)18(3,4)5/h7-12H,1-6H3 |
| InChIKey | QIAMVKQDQIAJCN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|