C14H17N3O3 — CID 35625729
1-[(2S)-2-(2,3-dihydro-1-benzofuran-5-ylamino)propanoyl]imidazolidin-2-one (PubChem CID 35625729) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 1-[(2S)-2-(2,3-dihydro-1-benzofuran-5-ylamino)propanoyl]imidazolidin-2-one.
| Compound Name | 1-[(2S)-2-(2,3-dihydro-1-benzofuran-5-ylamino)propanoyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 35625729 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 1-[(2S)-2-(2,3-dihydro-1-benzofuran-5-ylamino)propanoyl]imidazolidin-2-one |
| SMILES | C[C@H](Nc1ccc2c(c1)CCO2)C(=O)N1CCNC1=O |
| InChI | InChI=1S/C14H17N3O3/c1-9(13(18)17-6-5-15-14(17)19)16-11-2-3-12-10(8-11)4-7-20-12/h2-3,8-9,16H,4-7H2,1H3,(H,15,19)/t9-/m0/s1 |
| InChIKey | YVBZPSGCEPMSGG-VIFPVBQESA-N |
| XLogP | 0.97 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|