C15H19N3O2 — CID 47010805
1-[2-(2,3-dihydro-1H-inden-5-ylamino)propanoyl]imidazolidin-2-one (PubChem CID 47010805) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 1-[2-(2,3-dihydro-1H-inden-5-ylamino)propanoyl]imidazolidin-2-one.
| Compound Name | 1-[2-(2,3-dihydro-1H-inden-5-ylamino)propanoyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 47010805 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 1-[2-(2,3-dihydro-1H-inden-5-ylamino)propanoyl]imidazolidin-2-one |
| SMILES | CC(Nc1ccc2c(c1)CCC2)C(=O)N1CCNC1=O |
| InChI | InChI=1S/C15H19N3O2/c1-10(14(19)18-8-7-16-15(18)20)17-13-6-5-11-3-2-4-12(11)9-13/h5-6,9-10,17H,2-4,7-8H2,1H3,(H,16,20) |
| InChIKey | CZQNUPQUSRTZKX-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |