C19H22FN3O3 — CID 35627370
(2R)-N-(ethylcarbamoyl)-2-[3-[(4-fluorophenyl)methoxy]anilino]propanamide (PubChem CID 35627370) has the molecular formula C19H22FN3O3 and a molecular weight of 359.40 g/mol. Its IUPAC name is (2R)-N-(ethylcarbamoyl)-2-[3-[(4-fluorophenyl)methoxy]anilino]propanamide.
| Compound Name | (2R)-N-(ethylcarbamoyl)-2-[3-[(4-fluorophenyl)methoxy]anilino]propanamide |
|---|---|
| PubChem CID | 35627370 |
| Molecular Formula | C19H22FN3O3 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | (2R)-N-(ethylcarbamoyl)-2-[3-[(4-fluorophenyl)methoxy]anilino]propanamide |
| SMILES | CCNC(=O)NC(=O)[C@@H](C)Nc1cccc(OCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C19H22FN3O3/c1-3-21-19(25)23-18(24)13(2)22-16-5-4-6-17(11-16)26-12-14-7-9-15(20)10-8-14/h4-11,13,22H,3,12H2,1-2H3,(H2,21,23,24,25)/t13-/m1/s1 |
| InChIKey | UERXNPHXTNZOMJ-CYBMUJFWSA-N |
| XLogP | 3.05 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |