C23H30N2O2 — CID 3564402
1-[[4-(dimethylamino)phenyl]-(2,4-dimethylphenyl)methyl]piperidine-3-carboxylic acid (PubChem CID 3564402) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 1-[[4-(dimethylamino)phenyl]-(2,4-dimethylphenyl)methyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[[4-(dimethylamino)phenyl]-(2,4-dimethylphenyl)methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 3564402 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 1-[[4-(dimethylamino)phenyl]-(2,4-dimethylphenyl)methyl]piperidine-3-carboxylic acid |
| SMILES | Cc1ccc(C(c2ccc(N(C)C)cc2)N2CCCC(C(=O)O)C2)c(C)c1 |
| InChI | InChI=1S/C23H30N2O2/c1-16-7-12-21(17(2)14-16)22(18-8-10-20(11-9-18)24(3)4)25-13-5-6-19(15-25)23(26)27/h7-12,14,19,22H,5-6,13,15H2,1-4H3,(H,26,27) |
| InChIKey | WQQHBRFONYRQSK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|