C20H17N3O3S — CID 35673708
6-ethyl-4-oxo-N-[2-(thiophen-2-ylmethyl)pyrazol-3-yl]chromene-2-carboxamide (PubChem CID 35673708) has the molecular formula C20H17N3O3S and a molecular weight of 379.44 g/mol. Its IUPAC name is 6-ethyl-4-oxo-N-[2-(thiophen-2-ylmethyl)pyrazol-3-yl]chromene-2-carboxamide.
| Compound Name | 6-ethyl-4-oxo-N-[2-(thiophen-2-ylmethyl)pyrazol-3-yl]chromene-2-carboxamide |
|---|---|
| PubChem CID | 35673708 |
| Molecular Formula | C20H17N3O3S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 6-ethyl-4-oxo-N-[2-(thiophen-2-ylmethyl)pyrazol-3-yl]chromene-2-carboxamide |
| SMILES | CCc1ccc2oc(C(=O)Nc3ccnn3Cc3cccs3)cc(=O)c2c1 |
| InChI | InChI=1S/C20H17N3O3S/c1-2-13-5-6-17-15(10-13)16(24)11-18(26-17)20(25)22-19-7-8-21-23(19)12-14-4-3-9-27-14/h3-11H,2,12H2,1H3,(H,22,25) |
| InChIKey | IEVIYXPKEUNHLO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |