C27H21Cl2N3O3 — CID 3567839
(4-amino-3-cyano-2-oxopent-3-enyl) 4-[(3,4-dichlorophenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylate (PubChem CID 3567839) has the molecular formula C27H21Cl2N3O3 and a molecular weight of 506.39 g/mol. Its IUPAC name is (4-amino-3-cyano-2-oxopent-3-enyl) 4-[(3,4-dichlorophenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylate.
| Compound Name | (4-amino-3-cyano-2-oxopent-3-enyl) 4-[(3,4-dichlorophenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylate |
|---|---|
| PubChem CID | 3567839 |
| Molecular Formula | C27H21Cl2N3O3 |
| Molecular Weight | 506.39 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | (4-amino-3-cyano-2-oxopent-3-enyl) 4-[(3,4-dichlorophenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylate |
| SMILES | CC(N)=C(C#N)C(=O)COC(=O)c1c2c(nc3ccccc13)C(=Cc1ccc(Cl)c(Cl)c1)CCC2 |
| InChI | InChI=1S/C27H21Cl2N3O3/c1-15(31)20(13-30)24(33)14-35-27(34)25-18-6-2-3-8-23(18)32-26-17(5-4-7-19(25)26)11-16-9-10-21(28)22(29)12-16/h2-3,6,8-12H,4-5,7,14,31H2,1H3 |
| InChIKey | SIYSFOMLMVHKJF-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.39 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|