C21H22N2O2 — CID 35688068
N,5-dimethyl-N-[(4-prop-2-enoxyphenyl)methyl]-1H-indole-2-carboxamide (PubChem CID 35688068) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is N,5-dimethyl-N-[(4-prop-2-enoxyphenyl)methyl]-1H-indole-2-carboxamide.
| Compound Name | N,5-dimethyl-N-[(4-prop-2-enoxyphenyl)methyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 35688068 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | N,5-dimethyl-N-[(4-prop-2-enoxyphenyl)methyl]-1H-indole-2-carboxamide |
| SMILES | C=CCOc1ccc(CN(C)C(=O)c2cc3cc(C)ccc3[nH]2)cc1 |
| InChI | InChI=1S/C21H22N2O2/c1-4-11-25-18-8-6-16(7-9-18)14-23(3)21(24)20-13-17-12-15(2)5-10-19(17)22-20/h4-10,12-13,22H,1,11,14H2,2-3H3 |
| InChIKey | DESKOILBTXTJHI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|