C17H20N2O4 — CID 35699759
1-(furan-3-carbonyl)-N-(furan-2-ylmethyl)-N-methylpiperidine-4-carboxamide (PubChem CID 35699759) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 1-(furan-3-carbonyl)-N-(furan-2-ylmethyl)-N-methylpiperidine-4-carboxamide.
| Compound Name | 1-(furan-3-carbonyl)-N-(furan-2-ylmethyl)-N-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 35699759 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 1-(furan-3-carbonyl)-N-(furan-2-ylmethyl)-N-methylpiperidine-4-carboxamide |
| SMILES | CN(Cc1ccco1)C(=O)C1CCN(C(=O)c2ccoc2)CC1 |
| InChI | InChI=1S/C17H20N2O4/c1-18(11-15-3-2-9-23-15)16(20)13-4-7-19(8-5-13)17(21)14-6-10-22-12-14/h2-3,6,9-10,12-13H,4-5,7-8,11H2,1H3 |
| InChIKey | IFRKRQZFTVUEOU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 66.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |