C19H22N2O3 — CID 35552274
N-benzyl-1-(furan-3-carbonyl)-N-methylpiperidine-4-carboxamide (PubChem CID 35552274) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is N-benzyl-1-(furan-3-carbonyl)-N-methylpiperidine-4-carboxamide.
| Compound Name | N-benzyl-1-(furan-3-carbonyl)-N-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 35552274 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | N-benzyl-1-(furan-3-carbonyl)-N-methylpiperidine-4-carboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)C1CCN(C(=O)c2ccoc2)CC1 |
| InChI | InChI=1S/C19H22N2O3/c1-20(13-15-5-3-2-4-6-15)18(22)16-7-10-21(11-8-16)19(23)17-9-12-24-14-17/h2-6,9,12,14,16H,7-8,10-11,13H2,1H3 |
| InChIKey | XYCAAAPGDMGGQZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |