C26H35N3O3 — CID 51132454
N-(1-benzylpiperidin-3-yl)-1-(furan-3-carbonyl)-N-propylpiperidine-4-carboxamide (PubChem CID 51132454) has the molecular formula C26H35N3O3 and a molecular weight of 437.58 g/mol. Its IUPAC name is N-(1-benzylpiperidin-3-yl)-1-(furan-3-carbonyl)-N-propylpiperidine-4-carboxamide.
| Compound Name | N-(1-benzylpiperidin-3-yl)-1-(furan-3-carbonyl)-N-propylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 51132454 |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | N-(1-benzylpiperidin-3-yl)-1-(furan-3-carbonyl)-N-propylpiperidine-4-carboxamide |
| SMILES | CCCN(C(=O)C1CCN(C(=O)c2ccoc2)CC1)C1CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C26H35N3O3/c1-2-13-29(24-9-6-14-27(19-24)18-21-7-4-3-5-8-21)26(31)22-10-15-28(16-11-22)25(30)23-12-17-32-20-23/h3-5,7-8,12,17,20,22,24H,2,6,9-11,13-16,18-19H2,1H3 |
| InChIKey | SPVGHTUDFXCZAG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 57.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |