C23H28N2O3 — CID 52511574
N-[(3R)-1-benzylpiperidin-3-yl]-N-propyl-1,3-benzodioxole-5-carboxamide (PubChem CID 52511574) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is N-[(3R)-1-benzylpiperidin-3-yl]-N-propyl-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(3R)-1-benzylpiperidin-3-yl]-N-propyl-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 52511574 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | N-[(3R)-1-benzylpiperidin-3-yl]-N-propyl-1,3-benzodioxole-5-carboxamide |
| SMILES | CCCN(C(=O)c1ccc2c(c1)OCO2)[C@@H]1CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C23H28N2O3/c1-2-12-25(23(26)19-10-11-21-22(14-19)28-17-27-21)20-9-6-13-24(16-20)15-18-7-4-3-5-8-18/h3-5,7-8,10-11,14,20H,2,6,9,12-13,15-17H2,1H3/t20-/m1/s1 |
| InChIKey | MLYXZDQYTGPOSY-HXUWFJFHSA-N |
| XLogP | 3.93 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |