C18H24N4OS — CID 95274228
N-[(3R)-1-benzylpiperidin-3-yl]-N-propylthiadiazole-5-carboxamide (PubChem CID 95274228) has the molecular formula C18H24N4OS and a molecular weight of 344.48 g/mol. Its IUPAC name is N-[(3R)-1-benzylpiperidin-3-yl]-N-propylthiadiazole-5-carboxamide.
| Compound Name | N-[(3R)-1-benzylpiperidin-3-yl]-N-propylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 95274228 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | N-[(3R)-1-benzylpiperidin-3-yl]-N-propylthiadiazole-5-carboxamide |
| SMILES | CCCN(C(=O)c1cnns1)[C@@H]1CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C18H24N4OS/c1-2-10-22(18(23)17-12-19-20-24-17)16-9-6-11-21(14-16)13-15-7-4-3-5-8-15/h3-5,7-8,12,16H,2,6,9-11,13-14H2,1H3/t16-/m1/s1 |
| InChIKey | HZEDAVHLVBLLBC-MRXNPFEDSA-N |
| XLogP | 3.05 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |