C24H23N3O5 — CID 35700889
N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-6-(2,5-dimethylfuran-3-yl)-N,3-dimethyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 35700889) has the molecular formula C24H23N3O5 and a molecular weight of 433.46 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-6-(2,5-dimethylfuran-3-yl)-N,3-dimethyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-6-(2,5-dimethylfuran-3-yl)-N,3-dimethyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 35700889 |
| Molecular Formula | C24H23N3O5 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-6-(2,5-dimethylfuran-3-yl)-N,3-dimethyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | Cc1cc(-c2cc(C(=O)N(C)Cc3ccc4c(c3)OCCO4)c3c(C)noc3n2)c(C)o1 |
| InChI | InChI=1S/C24H23N3O5/c1-13-9-17(15(3)31-13)19-11-18(22-14(2)26-32-23(22)25-19)24(28)27(4)12-16-5-6-20-21(10-16)30-8-7-29-20/h5-6,9-11H,7-8,12H2,1-4H3 |
| InChIKey | FSJHWEKMAUNMBB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 90.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |