C18H20N2O2S — CID 3570121
1-(2-ethylimino-1,3-benzothiazol-3-yl)-3-phenoxypropan-2-ol (PubChem CID 3570121) has the molecular formula C18H20N2O2S and a molecular weight of 328.44 g/mol. Its IUPAC name is 1-(2-ethylimino-1,3-benzothiazol-3-yl)-3-phenoxypropan-2-ol.
| Compound Name | 1-(2-ethylimino-1,3-benzothiazol-3-yl)-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 3570121 |
| Molecular Formula | C18H20N2O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 1-(2-ethylimino-1,3-benzothiazol-3-yl)-3-phenoxypropan-2-ol |
| SMILES | CC/N=c1\sc2ccccc2n1CC(O)COc1ccccc1 |
| InChI | InChI=1S/C18H20N2O2S/c1-2-19-18-20(16-10-6-7-11-17(16)23-18)12-14(21)13-22-15-8-4-3-5-9-15/h3-11,14,21H,2,12-13H2,1H3/b19-18- |
| InChIKey | WFIDMBLQNBLRND-HNENSFHCSA-N |
| XLogP | 3.06 |
| TPSA | 46.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |