C22H26N2O2S — CID 7538422
(2R)-1-(2-cyclohexylimino-1,3-benzothiazol-3-yl)-3-phenoxypropan-2-ol (PubChem CID 7538422) has the molecular formula C22H26N2O2S and a molecular weight of 382.53 g/mol. Its IUPAC name is (2R)-1-(2-cyclohexylimino-1,3-benzothiazol-3-yl)-3-phenoxypropan-2-ol.
| Compound Name | (2R)-1-(2-cyclohexylimino-1,3-benzothiazol-3-yl)-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 7538422 |
| Molecular Formula | C22H26N2O2S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | (2R)-1-(2-cyclohexylimino-1,3-benzothiazol-3-yl)-3-phenoxypropan-2-ol |
| SMILES | O[C@@H](COc1ccccc1)Cn1/c(=N/C2CCCCC2)sc2ccccc21 |
| InChI | InChI=1S/C22H26N2O2S/c25-18(16-26-19-11-5-2-6-12-19)15-24-20-13-7-8-14-21(20)27-22(24)23-17-9-3-1-4-10-17/h2,5-8,11-14,17-18,25H,1,3-4,9-10,15-16H2/b23-22-/t18-/m1/s1 |
| InChIKey | PAWJDRDAQUEAHQ-LINNUKDLSA-N |
| XLogP | 4.38 |
| TPSA | 46.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |