C22H25N5O3S — CID 35705492
N-[4-(cyanomethyl)phenyl]-3-[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]propanamide (PubChem CID 35705492) has the molecular formula C22H25N5O3S and a molecular weight of 439.54 g/mol. Its IUPAC name is N-[4-(cyanomethyl)phenyl]-3-[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]propanamide.
| Compound Name | N-[4-(cyanomethyl)phenyl]-3-[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]propanamide |
|---|---|
| PubChem CID | 35705492 |
| Molecular Formula | C22H25N5O3S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | N-[4-(cyanomethyl)phenyl]-3-[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]propanamide |
| SMILES | CCn1c(CCC(=O)Nc2ccc(CC#N)cc2)nc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C22H25N5O3S/c1-4-27-20-10-9-18(31(29,30)26(2)3)15-19(20)25-21(27)11-12-22(28)24-17-7-5-16(6-8-17)13-14-23/h5-10,15H,4,11-13H2,1-3H3,(H,24,28) |
| InChIKey | LVINPMOYDCKJFL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 108.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |