C28H31N3O5S — CID 3571709
N-butyl-N-[2-[4-(4-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-4-methyl-3-nitrobenzamide (PubChem CID 3571709) has the molecular formula C28H31N3O5S and a molecular weight of 521.64 g/mol. Its IUPAC name is N-butyl-N-[2-[4-(4-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-4-methyl-3-nitrobenzamide.
| Compound Name | N-butyl-N-[2-[4-(4-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 3571709 |
| Molecular Formula | C28H31N3O5S |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | N-butyl-N-[2-[4-(4-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-4-methyl-3-nitrobenzamide |
| SMILES | CCCCN(CC(=O)N1CCc2sccc2C1c1ccc(OC)cc1)C(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H31N3O5S/c1-4-5-14-29(28(33)21-7-6-19(2)24(17-21)31(34)35)18-26(32)30-15-12-25-23(13-16-37-25)27(30)20-8-10-22(36-3)11-9-20/h6-11,13,16-17,27H,4-5,12,14-15,18H2,1-3H3 |
| InChIKey | GPVXETBIGKVUQG-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|