C27H26Cl3N3O4S — CID 3458441
4-chloro-N-[2-[4-(2,4-dichlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-3-nitro-N-pentylbenzamide (PubChem CID 3458441) has the molecular formula C27H26Cl3N3O4S and a molecular weight of 594.95 g/mol. Its IUPAC name is 4-chloro-N-[2-[4-(2,4-dichlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-3-nitro-N-pentylbenzamide.
| Compound Name | 4-chloro-N-[2-[4-(2,4-dichlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-3-nitro-N-pentylbenzamide |
|---|---|
| PubChem CID | 3458441 |
| Molecular Formula | C27H26Cl3N3O4S |
| Molecular Weight | 594.95 g/mol |
| Exact Mass | 593.07 |
| IUPAC Name | 4-chloro-N-[2-[4-(2,4-dichlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-3-nitro-N-pentylbenzamide |
| SMILES | CCCCCN(CC(=O)N1CCc2sccc2C1c1ccc(Cl)cc1Cl)C(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H26Cl3N3O4S/c1-2-3-4-11-31(27(35)17-5-8-21(29)23(14-17)33(36)37)16-25(34)32-12-9-24-20(10-13-38-24)26(32)19-7-6-18(28)15-22(19)30/h5-8,10,13-15,26H,2-4,9,11-12,16H2,1H3 |
| InChIKey | QFEJEFMJGWZPHN-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.95 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|