C25H23Cl2N3O4S — CID 5031833
N-[2-[4-(2,4-dichlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-4-nitro-N-propan-2-ylbenzamide (PubChem CID 5031833) has the molecular formula C25H23Cl2N3O4S and a molecular weight of 532.45 g/mol. Its IUPAC name is N-[2-[4-(2,4-dichlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-4-nitro-N-propan-2-ylbenzamide.
| Compound Name | N-[2-[4-(2,4-dichlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-4-nitro-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 5031833 |
| Molecular Formula | C25H23Cl2N3O4S |
| Molecular Weight | 532.45 g/mol |
| Exact Mass | 531.08 |
| IUPAC Name | N-[2-[4-(2,4-dichlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-4-nitro-N-propan-2-ylbenzamide |
| SMILES | CC(C)N(CC(=O)N1CCc2sccc2C1c1ccc(Cl)cc1Cl)C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H23Cl2N3O4S/c1-15(2)29(25(32)16-3-6-18(7-4-16)30(33)34)14-23(31)28-11-9-22-20(10-12-35-22)24(28)19-8-5-17(26)13-21(19)27/h3-8,10,12-13,15,24H,9,11,14H2,1-2H3 |
| InChIKey | FFXVUDYOXIHILN-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.45 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|