C24H20Cl2N2O4 — CID 35719335
N,N'-bis(2-chlorophenyl)-2-[(3-ethoxy-4-hydroxyphenyl)methylidene]propanediamide (PubChem CID 35719335) has the molecular formula C24H20Cl2N2O4 and a molecular weight of 471.34 g/mol. Its IUPAC name is N,N'-bis(2-chlorophenyl)-2-[(3-ethoxy-4-hydroxyphenyl)methylidene]propanediamide.
| Compound Name | N,N'-bis(2-chlorophenyl)-2-[(3-ethoxy-4-hydroxyphenyl)methylidene]propanediamide |
|---|---|
| PubChem CID | 35719335 |
| Molecular Formula | C24H20Cl2N2O4 |
| Molecular Weight | 471.34 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | N,N'-bis(2-chlorophenyl)-2-[(3-ethoxy-4-hydroxyphenyl)methylidene]propanediamide |
| SMILES | CCOc1cc(C=C(C(=O)Nc2ccccc2Cl)C(=O)Nc2ccccc2Cl)ccc1O |
| InChI | InChI=1S/C24H20Cl2N2O4/c1-2-32-22-14-15(11-12-21(22)29)13-16(23(30)27-19-9-5-3-7-17(19)25)24(31)28-20-10-6-4-8-18(20)26/h3-14,29H,2H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | VDHPEGUPDPSXEG-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.34 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|