C25H17Cl2N3O2 — CID 55355645
N,N'-bis(2-chlorophenyl)-2-(quinolin-6-ylmethylidene)propanediamide (PubChem CID 55355645) has the molecular formula C25H17Cl2N3O2 and a molecular weight of 462.34 g/mol. Its IUPAC name is N,N'-bis(2-chlorophenyl)-2-(quinolin-6-ylmethylidene)propanediamide.
| Compound Name | N,N'-bis(2-chlorophenyl)-2-(quinolin-6-ylmethylidene)propanediamide |
|---|---|
| PubChem CID | 55355645 |
| Molecular Formula | C25H17Cl2N3O2 |
| Molecular Weight | 462.34 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | N,N'-bis(2-chlorophenyl)-2-(quinolin-6-ylmethylidene)propanediamide |
| SMILES | O=C(Nc1ccccc1Cl)C(=Cc1ccc2ncccc2c1)C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C25H17Cl2N3O2/c26-19-7-1-3-9-22(19)29-24(31)18(25(32)30-23-10-4-2-8-20(23)27)15-16-11-12-21-17(14-16)6-5-13-28-21/h1-15H,(H,29,31)(H,30,32) |
| InChIKey | SSPQIUQQBGUTID-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.34 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|