C12H16N4O+2 — CID 3574746
[1-[(4-amino-2-methylpyrimidin-1-ium-5-yl)methyl]pyridin-1-ium-3-yl]methanol (PubChem CID 3574746) has the molecular formula C12H16N4O+2 and a molecular weight of 232.29 g/mol. Its IUPAC name is [1-[(4-amino-2-methylpyrimidin-1-ium-5-yl)methyl]pyridin-1-ium-3-yl]methanol.
| Compound Name | [1-[(4-amino-2-methylpyrimidin-1-ium-5-yl)methyl]pyridin-1-ium-3-yl]methanol |
|---|---|
| PubChem CID | 3574746 |
| Molecular Formula | C12H16N4O+2 |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | [1-[(4-amino-2-methylpyrimidin-1-ium-5-yl)methyl]pyridin-1-ium-3-yl]methanol |
| SMILES | Cc1nc(N)c(C[n+]2cccc(CO)c2)c[nH+]1 |
| InChI | InChI=1S/C12H15N4O/c1-9-14-5-11(12(13)15-9)7-16-4-2-3-10(6-16)8-17/h2-6,17H,7-8H2,1H3,(H2,13,14,15)/q+1/p+1 |
| InChIKey | UPDCOTIARDJPMV-UHFFFAOYSA-O |
| XLogP | -0.39 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|