C24H27N5O2 — CID 3574771
3-(1-benzylpiperidin-3-yl)-1-(2-methyl-5-nitrophenyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole (PubChem CID 3574771) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is 3-(1-benzylpiperidin-3-yl)-1-(2-methyl-5-nitrophenyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole.
| Compound Name | 3-(1-benzylpiperidin-3-yl)-1-(2-methyl-5-nitrophenyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole |
|---|---|
| PubChem CID | 3574771 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 3-(1-benzylpiperidin-3-yl)-1-(2-methyl-5-nitrophenyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole |
| SMILES | Cc1ccc([N+](=O)[O-])cc1-n1nc(C2CCCN(Cc3ccccc3)C2)c2c1NCC2 |
| InChI | InChI=1S/C24H27N5O2/c1-17-9-10-20(29(30)31)14-22(17)28-24-21(11-12-25-24)23(26-28)19-8-5-13-27(16-19)15-18-6-3-2-4-7-18/h2-4,6-7,9-10,14,19,25H,5,8,11-13,15-16H2,1H3 |
| InChIKey | MQYGZJJXALCKDQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|