C18H23N5S — CID 3492137
3-(1-benzylpiperidin-3-yl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole-1-carbothioamide (PubChem CID 3492137) has the molecular formula C18H23N5S and a molecular weight of 341.48 g/mol. Its IUPAC name is 3-(1-benzylpiperidin-3-yl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole-1-carbothioamide.
| Compound Name | 3-(1-benzylpiperidin-3-yl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole-1-carbothioamide |
|---|---|
| PubChem CID | 3492137 |
| Molecular Formula | C18H23N5S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 3-(1-benzylpiperidin-3-yl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole-1-carbothioamide |
| SMILES | NC(=S)n1nc(C2CCCN(Cc3ccccc3)C2)c2c1NCC2 |
| InChI | InChI=1S/C18H23N5S/c19-18(24)23-17-15(8-9-20-17)16(21-23)14-7-4-10-22(12-14)11-13-5-2-1-3-6-13/h1-3,5-6,14,20H,4,7-12H2,(H2,19,24) |
| InChIKey | GKWIHLJYGGDIGF-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|