C9H9ClN4O2 — CID 35754836
[5-[(2-chlorophenoxy)methyl]-1,3,4-oxadiazol-2-yl]hydrazine (PubChem CID 35754836) has the molecular formula C9H9ClN4O2 and a molecular weight of 240.65 g/mol. Its IUPAC name is [5-[(2-chlorophenoxy)methyl]-1,3,4-oxadiazol-2-yl]hydrazine.
| Compound Name | [5-[(2-chlorophenoxy)methyl]-1,3,4-oxadiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 35754836 |
| Molecular Formula | C9H9ClN4O2 |
| Molecular Weight | 240.65 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | [5-[(2-chlorophenoxy)methyl]-1,3,4-oxadiazol-2-yl]hydrazine |
| SMILES | NNc1nnc(COc2ccccc2Cl)o1 |
| InChI | InChI=1S/C9H9ClN4O2/c10-6-3-1-2-4-7(6)15-5-8-13-14-9(12-11)16-8/h1-4H,5,11H2,(H,12,14) |
| InChIKey | PNEFTVNYUWYIQO-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 86.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.65 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|