C16H12Cl2N2O2 — CID 110655983
2-benzyl-5-[(2,3-dichlorophenoxy)methyl]-1,3,4-oxadiazole (PubChem CID 110655983) has the molecular formula C16H12Cl2N2O2 and a molecular weight of 335.19 g/mol. Its IUPAC name is 2-benzyl-5-[(2,3-dichlorophenoxy)methyl]-1,3,4-oxadiazole.
| Compound Name | 2-benzyl-5-[(2,3-dichlorophenoxy)methyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 110655983 |
| Molecular Formula | C16H12Cl2N2O2 |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 2-benzyl-5-[(2,3-dichlorophenoxy)methyl]-1,3,4-oxadiazole |
| SMILES | Clc1cccc(OCc2nnc(Cc3ccccc3)o2)c1Cl |
| InChI | InChI=1S/C16H12Cl2N2O2/c17-12-7-4-8-13(16(12)18)21-10-15-20-19-14(22-15)9-11-5-2-1-3-6-11/h1-8H,9-10H2 |
| InChIKey | MRUMGCVTBGDOLX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |