C11H14ClN5 — CID 35754979
[5-[2-(3-chlorophenyl)ethyl]-4-methyl-1,2,4-triazol-3-yl]hydrazine (PubChem CID 35754979) has the molecular formula C11H14ClN5 and a molecular weight of 251.72 g/mol. Its IUPAC name is [5-[2-(3-chlorophenyl)ethyl]-4-methyl-1,2,4-triazol-3-yl]hydrazine.
| Compound Name | [5-[2-(3-chlorophenyl)ethyl]-4-methyl-1,2,4-triazol-3-yl]hydrazine |
|---|---|
| PubChem CID | 35754979 |
| Molecular Formula | C11H14ClN5 |
| Molecular Weight | 251.72 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | [5-[2-(3-chlorophenyl)ethyl]-4-methyl-1,2,4-triazol-3-yl]hydrazine |
| SMILES | Cn1c(CCc2cccc(Cl)c2)nnc1NN |
| InChI | InChI=1S/C11H14ClN5/c1-17-10(15-16-11(17)14-13)6-5-8-3-2-4-9(12)7-8/h2-4,7H,5-6,13H2,1H3,(H,14,16) |
| InChIKey | JBGSMPBJKQEDFF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.72 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|