C20H28O2 — CID 35755468
(3S,6S,7R,11S)-3,10,14-trimethyl-6-propan-2-yltricyclo[9.3.0.03,7]tetradeca-1(14),9-diene-4,13-dione (PubChem CID 35755468) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is (3S,6S,7R,11S)-3,10,14-trimethyl-6-propan-2-yltricyclo[9.3.0.03,7]tetradeca-1(14),9-diene-4,13-dione.
| Compound Name | (3S,6S,7R,11S)-3,10,14-trimethyl-6-propan-2-yltricyclo[9.3.0.03,7]tetradeca-1(14),9-diene-4,13-dione |
|---|---|
| PubChem CID | 35755468 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (3S,6S,7R,11S)-3,10,14-trimethyl-6-propan-2-yltricyclo[9.3.0.03,7]tetradeca-1(14),9-diene-4,13-dione |
| SMILES | CC1=CC[C@@H]2[C@H](C(C)C)CC(=O)[C@@]2(C)CC2=C(C)C(=O)C[C@@H]12 |
| InChI | InChI=1S/C20H28O2/c1-11(2)14-9-19(22)20(5)10-16-13(4)18(21)8-15(16)12(3)6-7-17(14)20/h6,11,14-15,17H,7-10H2,1-5H3/t14-,15-,17+,20-/m0/s1 |
| InChIKey | RQBPREVSQRPKAH-COCVIAQXSA-N |
| XLogP | 4.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|