C23H26N4O5S — CID 35755912
6-(3,4-dimethoxyanilino)-3-[(3,4-dimethoxyphenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazin-5-one (PubChem CID 35755912) has the molecular formula C23H26N4O5S and a molecular weight of 470.55 g/mol. Its IUPAC name is 6-(3,4-dimethoxyanilino)-3-[(3,4-dimethoxyphenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazin-5-one.
| Compound Name | 6-(3,4-dimethoxyanilino)-3-[(3,4-dimethoxyphenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 35755912 |
| Molecular Formula | C23H26N4O5S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | 6-(3,4-dimethoxyanilino)-3-[(3,4-dimethoxyphenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazin-5-one |
| SMILES | C=CCn1c(SCc2ccc(OC)c(OC)c2)nnc(Nc2ccc(OC)c(OC)c2)c1=O |
| InChI | InChI=1S/C23H26N4O5S/c1-6-11-27-22(28)21(24-16-8-10-18(30-3)20(13-16)32-5)25-26-23(27)33-14-15-7-9-17(29-2)19(12-15)31-4/h6-10,12-13H,1,11,14H2,2-5H3,(H,24,25) |
| InChIKey | VSIUCJWPBAFTLB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|