C19H16BrClN4OS — CID 35755952
3-[(4-bromophenyl)methylsulfanyl]-6-(3-chloroanilino)-4-prop-2-enyl-1,2,4-triazin-5-one (PubChem CID 35755952) has the molecular formula C19H16BrClN4OS and a molecular weight of 463.79 g/mol. Its IUPAC name is 3-[(4-bromophenyl)methylsulfanyl]-6-(3-chloroanilino)-4-prop-2-enyl-1,2,4-triazin-5-one.
| Compound Name | 3-[(4-bromophenyl)methylsulfanyl]-6-(3-chloroanilino)-4-prop-2-enyl-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 35755952 |
| Molecular Formula | C19H16BrClN4OS |
| Molecular Weight | 463.79 g/mol |
| Exact Mass | 461.99 |
| IUPAC Name | 3-[(4-bromophenyl)methylsulfanyl]-6-(3-chloroanilino)-4-prop-2-enyl-1,2,4-triazin-5-one |
| SMILES | C=CCn1c(SCc2ccc(Br)cc2)nnc(Nc2cccc(Cl)c2)c1=O |
| InChI | InChI=1S/C19H16BrClN4OS/c1-2-10-25-18(26)17(22-16-5-3-4-15(21)11-16)23-24-19(25)27-12-13-6-8-14(20)9-7-13/h2-9,11H,1,10,12H2,(H,22,23) |
| InChIKey | OWFZOZIYGJEPLM-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.79 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|