C16H25N7O — CID 35757406
N-butyl-4-(1,3-dimethylpyrazolo[4,5-d]pyrimidin-7-yl)piperazine-1-carboxamide (PubChem CID 35757406) has the molecular formula C16H25N7O and a molecular weight of 331.42 g/mol. Its IUPAC name is N-butyl-4-(1,3-dimethylpyrazolo[4,5-d]pyrimidin-7-yl)piperazine-1-carboxamide.
| Compound Name | N-butyl-4-(1,3-dimethylpyrazolo[4,5-d]pyrimidin-7-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 35757406 |
| Molecular Formula | C16H25N7O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | N-butyl-4-(1,3-dimethylpyrazolo[4,5-d]pyrimidin-7-yl)piperazine-1-carboxamide |
| SMILES | CCCCNC(=O)N1CCN(c2ncnc3c(C)nn(C)c23)CC1 |
| InChI | InChI=1S/C16H25N7O/c1-4-5-6-17-16(24)23-9-7-22(8-10-23)15-14-13(18-11-19-15)12(2)20-21(14)3/h11H,4-10H2,1-3H3,(H,17,24) |
| InChIKey | AIUZXPAMGCTURC-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|