C18H15Cl2N3O4 — CID 3576394
4-chloro-N-(3-chlorophenyl)-3-nitro-N-[(2-oxopyrrolidin-1-yl)methyl]benzamide (PubChem CID 3576394) has the molecular formula C18H15Cl2N3O4 and a molecular weight of 408.24 g/mol. Its IUPAC name is 4-chloro-N-(3-chlorophenyl)-3-nitro-N-[(2-oxopyrrolidin-1-yl)methyl]benzamide.
| Compound Name | 4-chloro-N-(3-chlorophenyl)-3-nitro-N-[(2-oxopyrrolidin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 3576394 |
| Molecular Formula | C18H15Cl2N3O4 |
| Molecular Weight | 408.24 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | 4-chloro-N-(3-chlorophenyl)-3-nitro-N-[(2-oxopyrrolidin-1-yl)methyl]benzamide |
| SMILES | O=C1CCCN1CN(C(=O)c1ccc(Cl)c([N+](=O)[O-])c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H15Cl2N3O4/c19-13-3-1-4-14(10-13)22(11-21-8-2-5-17(21)24)18(25)12-6-7-15(20)16(9-12)23(26)27/h1,3-4,6-7,9-10H,2,5,8,11H2 |
| InChIKey | WFPBNTQUDNMIGJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.24 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|