C18H15ClN4O6 — CID 4098524
4-chloro-3-nitro-N-(4-nitrophenyl)-N-[(2-oxopyrrolidin-1-yl)methyl]benzamide (PubChem CID 4098524) has the molecular formula C18H15ClN4O6 and a molecular weight of 418.79 g/mol. Its IUPAC name is 4-chloro-3-nitro-N-(4-nitrophenyl)-N-[(2-oxopyrrolidin-1-yl)methyl]benzamide.
| Compound Name | 4-chloro-3-nitro-N-(4-nitrophenyl)-N-[(2-oxopyrrolidin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 4098524 |
| Molecular Formula | C18H15ClN4O6 |
| Molecular Weight | 418.79 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | 4-chloro-3-nitro-N-(4-nitrophenyl)-N-[(2-oxopyrrolidin-1-yl)methyl]benzamide |
| SMILES | O=C1CCCN1CN(C(=O)c1ccc(Cl)c([N+](=O)[O-])c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H15ClN4O6/c19-15-8-3-12(10-16(15)23(28)29)18(25)21(11-20-9-1-2-17(20)24)13-4-6-14(7-5-13)22(26)27/h3-8,10H,1-2,9,11H2 |
| InChIKey | OKDACWWCFXUQBP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 126.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.79 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|