C23H30N4O4 — CID 35768566
N-[(2S)-1-[2-[3-(dimethylamino)benzoyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-ethoxybenzamide (PubChem CID 35768566) has the molecular formula C23H30N4O4 and a molecular weight of 426.52 g/mol. Its IUPAC name is N-[(2S)-1-[2-[3-(dimethylamino)benzoyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-ethoxybenzamide.
| Compound Name | N-[(2S)-1-[2-[3-(dimethylamino)benzoyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 35768566 |
| Molecular Formula | C23H30N4O4 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | N-[(2S)-1-[2-[3-(dimethylamino)benzoyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N[C@H](C(=O)NNC(=O)c2cccc(N(C)C)c2)C(C)C)cc1 |
| InChI | InChI=1S/C23H30N4O4/c1-6-31-19-12-10-16(11-13-19)21(28)24-20(15(2)3)23(30)26-25-22(29)17-8-7-9-18(14-17)27(4)5/h7-15,20H,6H2,1-5H3,(H,24,28)(H,25,29)(H,26,30)/t20-/m0/s1 |
| InChIKey | MGYGOGVMJUSONI-FQEVSTJZSA-N |
| XLogP | 2.37 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|