C22H28N4O4 — CID 26262502
benzyl N-[(2S)-1-[2-[3-(dimethylamino)benzoyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 26262502) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[2-[3-(dimethylamino)benzoyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[2-[3-(dimethylamino)benzoyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 26262502 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | benzyl N-[(2S)-1-[2-[3-(dimethylamino)benzoyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)NNC(=O)c1cccc(N(C)C)c1 |
| InChI | InChI=1S/C22H28N4O4/c1-15(2)19(23-22(29)30-14-16-9-6-5-7-10-16)21(28)25-24-20(27)17-11-8-12-18(13-17)26(3)4/h5-13,15,19H,14H2,1-4H3,(H,23,29)(H,24,27)(H,25,28)/t19-/m0/s1 |
| InChIKey | NGLLGXUOAOJMMS-IBGZPJMESA-N |
| XLogP | 2.46 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|