C22H20BrNOS — CID 3578654
[3-bromo-4-(naphthalen-2-ylmethoxy)phenyl]-pyrrolidin-1-ylmethanethione (PubChem CID 3578654) has the molecular formula C22H20BrNOS and a molecular weight of 426.38 g/mol. Its IUPAC name is [3-bromo-4-(naphthalen-2-ylmethoxy)phenyl]-pyrrolidin-1-ylmethanethione.
| Compound Name | [3-bromo-4-(naphthalen-2-ylmethoxy)phenyl]-pyrrolidin-1-ylmethanethione |
|---|---|
| PubChem CID | 3578654 |
| Molecular Formula | C22H20BrNOS |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | [3-bromo-4-(naphthalen-2-ylmethoxy)phenyl]-pyrrolidin-1-ylmethanethione |
| SMILES | S=C(c1ccc(OCc2ccc3ccccc3c2)c(Br)c1)N1CCCC1 |
| InChI | InChI=1S/C22H20BrNOS/c23-20-14-19(22(26)24-11-3-4-12-24)9-10-21(20)25-15-16-7-8-17-5-1-2-6-18(17)13-16/h1-2,5-10,13-14H,3-4,11-12,15H2 |
| InChIKey | GLMQPENKIJDTIB-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|