C20H16ClN3O3S2 — CID 35804874
N-[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]-4-(prop-2-ynylsulfamoyl)benzamide (PubChem CID 35804874) has the molecular formula C20H16ClN3O3S2 and a molecular weight of 445.95 g/mol. Its IUPAC name is N-[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]-4-(prop-2-ynylsulfamoyl)benzamide.
| Compound Name | N-[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]-4-(prop-2-ynylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 35804874 |
| Molecular Formula | C20H16ClN3O3S2 |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.03 |
| IUPAC Name | N-[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]-4-(prop-2-ynylsulfamoyl)benzamide |
| SMILES | C#CCNS(=O)(=O)c1ccc(C(=O)Nc2ncc(Cc3ccccc3Cl)s2)cc1 |
| InChI | InChI=1S/C20H16ClN3O3S2/c1-2-11-23-29(26,27)17-9-7-14(8-10-17)19(25)24-20-22-13-16(28-20)12-15-5-3-4-6-18(15)21/h1,3-10,13,23H,11-12H2,(H,22,24,25) |
| InChIKey | GIMCSNLLPPGMDJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|