C20H16Cl2N4O3S2 — CID 29363584
4-(2-cyanoethylsulfamoyl)-N-[5-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 29363584) has the molecular formula C20H16Cl2N4O3S2 and a molecular weight of 495.41 g/mol. Its IUPAC name is 4-(2-cyanoethylsulfamoyl)-N-[5-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-(2-cyanoethylsulfamoyl)-N-[5-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 29363584 |
| Molecular Formula | C20H16Cl2N4O3S2 |
| Molecular Weight | 495.41 g/mol |
| Exact Mass | 494.00 |
| IUPAC Name | 4-(2-cyanoethylsulfamoyl)-N-[5-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | N#CCCNS(=O)(=O)c1ccc(C(=O)Nc2ncc(Cc3ccc(Cl)cc3Cl)s2)cc1 |
| InChI | InChI=1S/C20H16Cl2N4O3S2/c21-15-5-2-14(18(22)11-15)10-16-12-24-20(30-16)26-19(27)13-3-6-17(7-4-13)31(28,29)25-9-1-8-23/h2-7,11-12,25H,1,9-10H2,(H,24,26,27) |
| InChIKey | FGFPHVJLEBHRHU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 111.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|