C8H14N2O2S — CID 35807274
2-(2-oxo-1,3-thiazolidin-3-yl)-N-propan-2-ylacetamide (PubChem CID 35807274) has the molecular formula C8H14N2O2S and a molecular weight of 202.28 g/mol. Its IUPAC name is 2-(2-oxo-1,3-thiazolidin-3-yl)-N-propan-2-ylacetamide.
| Compound Name | 2-(2-oxo-1,3-thiazolidin-3-yl)-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 35807274 |
| Molecular Formula | C8H14N2O2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 2-(2-oxo-1,3-thiazolidin-3-yl)-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CN1CCSC1=O |
| InChI | InChI=1S/C8H14N2O2S/c1-6(2)9-7(11)5-10-3-4-13-8(10)12/h6H,3-5H2,1-2H3,(H,9,11) |
| InChIKey | GVZKDZCRBCRVON-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|