C8H15N3O2S — CID 119504103
N-[2-(methylamino)ethyl]-2-(2-oxo-1,3-thiazolidin-3-yl)acetamide (PubChem CID 119504103) has the molecular formula C8H15N3O2S and a molecular weight of 217.29 g/mol. Its IUPAC name is N-[2-(methylamino)ethyl]-2-(2-oxo-1,3-thiazolidin-3-yl)acetamide.
| Compound Name | N-[2-(methylamino)ethyl]-2-(2-oxo-1,3-thiazolidin-3-yl)acetamide |
|---|---|
| PubChem CID | 119504103 |
| Molecular Formula | C8H15N3O2S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | N-[2-(methylamino)ethyl]-2-(2-oxo-1,3-thiazolidin-3-yl)acetamide |
| SMILES | CNCCNC(=O)CN1CCSC1=O |
| InChI | InChI=1S/C8H15N3O2S/c1-9-2-3-10-7(12)6-11-4-5-14-8(11)13/h9H,2-6H2,1H3,(H,10,12) |
| InChIKey | YOSKVEDODZUFCQ-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|