4-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]butanoic acid

C9H14N2O4S — CID 119352739

IUPAC4-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]butanoic acid
SMILESO=C(O)CCCNC(=O)CN1CCSC1=O
InChIInChI=1S/C9H14N2O4S/c12-7(10-3-1-2-8(13)14)6-11-4-5-16-9(11)15/h1-6H2,(H,10,12)(H,13,14)
InChIKeySRJUCTMPZIBHJY-UHFFFAOYSA-N
MW246.29 g/mol
LogP0.14
Rot. Bonds6

About 4-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]butanoic acid

4-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]butanoic acid (PubChem CID 119352739) has the molecular formula C9H14N2O4S and a molecular weight of 246.29 g/mol. Its IUPAC name is 4-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]butanoic acid.

Molecular Properties

Compound Name4-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]butanoic acid
PubChem CID119352739
Molecular FormulaC9H14N2O4S
Molecular Weight246.29 g/mol
Exact Mass246.07
IUPAC Name4-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]butanoic acid
SMILESO=C(O)CCCNC(=O)CN1CCSC1=O
InChIInChI=1S/C9H14N2O4S/c12-7(10-3-1-2-8(13)14)6-11-4-5-16-9(11)15/h1-6H2,(H,10,12)(H,13,14)
InChIKeySRJUCTMPZIBHJY-UHFFFAOYSA-N
XLogP0.14
TPSA86.71 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.29
LogP ≤ 50.14
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}

Analyze 4-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]butanoic acid?
The IUPAC name of 4-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]butanoic acid (CID 119352739) is 4-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]butanoic acid.
What is the SMILES notation for 4-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]butanoic acid?
The canonical SMILES for 4-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]butanoic acid is O=C(O)CCCNC(=O)CN1CCSC1=O.
What is the InChIKey of 4-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]butanoic acid?
The InChIKey is SRJUCTMPZIBHJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O4S/c12-7(10-3-1-2-8(13)14)6-11-4-5-16-9(11)15/h1-6H2,(H,10,12)(H,13,14).
What are the key properties of 4-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]butanoic acid?
4-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]butanoic acid has a molecular weight of 246.29 g/mol, XLogP of 0.14, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]butanoic acid is sourced from PubChem (CID 119352739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).