C11H18N2O4S — CID 119357474
4-methyl-4-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]pentanoic acid (PubChem CID 119357474) has the molecular formula C11H18N2O4S and a molecular weight of 274.34 g/mol. Its IUPAC name is 4-methyl-4-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]pentanoic acid.
| Compound Name | 4-methyl-4-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 119357474 |
| Molecular Formula | C11H18N2O4S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 4-methyl-4-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]pentanoic acid |
| SMILES | CC(C)(CCC(=O)O)NC(=O)CN1CCSC1=O |
| InChI | InChI=1S/C11H18N2O4S/c1-11(2,4-3-9(15)16)12-8(14)7-13-5-6-18-10(13)17/h3-7H2,1-2H3,(H,12,14)(H,15,16) |
| InChIKey | GWDBNLHAZCSOHK-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|