C10H16N2O5S — CID 79468019
2-[2-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoylamino]ethoxy]acetic acid (PubChem CID 79468019) has the molecular formula C10H16N2O5S and a molecular weight of 276.31 g/mol. Its IUPAC name is 2-[2-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoylamino]ethoxy]acetic acid.
| Compound Name | 2-[2-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoylamino]ethoxy]acetic acid |
|---|---|
| PubChem CID | 79468019 |
| Molecular Formula | C10H16N2O5S |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 2-[2-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoylamino]ethoxy]acetic acid |
| SMILES | O=C(O)COCCNC(=O)CCN1CCSC1=O |
| InChI | InChI=1S/C10H16N2O5S/c13-8(11-2-5-17-7-9(14)15)1-3-12-4-6-18-10(12)16/h1-7H2,(H,11,13)(H,14,15) |
| InChIKey | MDYJKAZHMBZHFV-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|