C15H18F2N2O3S — CID 18116822
N-[2-[4-(difluoromethoxy)phenyl]ethyl]-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide (PubChem CID 18116822) has the molecular formula C15H18F2N2O3S and a molecular weight of 344.38 g/mol. Its IUPAC name is N-[2-[4-(difluoromethoxy)phenyl]ethyl]-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide.
| Compound Name | N-[2-[4-(difluoromethoxy)phenyl]ethyl]-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide |
|---|---|
| PubChem CID | 18116822 |
| Molecular Formula | C15H18F2N2O3S |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | N-[2-[4-(difluoromethoxy)phenyl]ethyl]-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide |
| SMILES | O=C(CCN1CCSC1=O)NCCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C15H18F2N2O3S/c16-14(17)22-12-3-1-11(2-4-12)5-7-18-13(20)6-8-19-9-10-23-15(19)21/h1-4,14H,5-10H2,(H,18,20) |
| InChIKey | WMSWOFVLGSKOKL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|