C9H14F2N2O3S — CID 103769998
N-(3,3-difluoro-2-hydroxypropyl)-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide (PubChem CID 103769998) has the molecular formula C9H14F2N2O3S and a molecular weight of 268.28 g/mol. Its IUPAC name is N-(3,3-difluoro-2-hydroxypropyl)-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide.
| Compound Name | N-(3,3-difluoro-2-hydroxypropyl)-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide |
|---|---|
| PubChem CID | 103769998 |
| Molecular Formula | C9H14F2N2O3S |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | N-(3,3-difluoro-2-hydroxypropyl)-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide |
| SMILES | O=C(CCN1CCSC1=O)NCC(O)C(F)F |
| InChI | InChI=1S/C9H14F2N2O3S/c10-8(11)6(14)5-12-7(15)1-2-13-3-4-17-9(13)16/h6,8,14H,1-5H2,(H,12,15) |
| InChIKey | LZBNVQOMCDEQOO-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|